C22H22F3NO4S — CID 174823027
2-[4-[4-amino-1-(4-fluorophenyl)sulfonyl-4-methylcyclohexyl]phenyl]-3,3-difluoroprop-2-enoic acid (PubChem CID 174823027) has the molecular formula C22H22F3NO4S and a molecular weight of 453.48 g/mol. Its IUPAC name is 2-[4-[4-amino-1-(4-fluorophenyl)sulfonyl-4-methylcyclohexyl]phenyl]-3,3-difluoroprop-2-enoic acid.
| Compound Name | 2-[4-[4-amino-1-(4-fluorophenyl)sulfonyl-4-methylcyclohexyl]phenyl]-3,3-difluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 174823027 |
| Molecular Formula | C22H22F3NO4S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-[4-[4-amino-1-(4-fluorophenyl)sulfonyl-4-methylcyclohexyl]phenyl]-3,3-difluoroprop-2-enoic acid |
| SMILES | CC1(N)CCC(c2ccc(C(C(=O)O)=C(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H22F3NO4S/c1-21(26)10-12-22(13-11-21,31(29,30)17-8-6-16(23)7-9-17)15-4-2-14(3-5-15)18(19(24)25)20(27)28/h2-9H,10-13,26H2,1H3,(H,27,28) |
| InChIKey | UHLIUVWZPMVLGU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|