C19H12F3NO4S — CID 174821517
3,3-difluoro-2-[4-[(3R)-3-(4-fluorophenyl)sulfonylpyrrol-3-yl]phenyl]prop-2-enoic acid (PubChem CID 174821517) has the molecular formula C19H12F3NO4S and a molecular weight of 407.37 g/mol. Its IUPAC name is 3,3-difluoro-2-[4-[(3R)-3-(4-fluorophenyl)sulfonylpyrrol-3-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3,3-difluoro-2-[4-[(3R)-3-(4-fluorophenyl)sulfonylpyrrol-3-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 174821517 |
| Molecular Formula | C19H12F3NO4S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 3,3-difluoro-2-[4-[(3R)-3-(4-fluorophenyl)sulfonylpyrrol-3-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C(=C(F)F)c1ccc([C@]2(S(=O)(=O)c3ccc(F)cc3)C=CN=C2)cc1 |
| InChI | InChI=1S/C19H12F3NO4S/c20-14-5-7-15(8-6-14)28(26,27)19(9-10-23-11-19)13-3-1-12(2-4-13)16(17(21)22)18(24)25/h1-11H,(H,24,25)/t19-/m0/s1 |
| InChIKey | BNXCABNNQSOXGE-IBGZPJMESA-N |
| XLogP | 3.79 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|