C11H10FNO4S — CID 122455974
(5S)-5-(4-fluorophenyl)sulfonyl-1,2-dihydropyrrole-5-carboxylic acid (PubChem CID 122455974) has the molecular formula C11H10FNO4S and a molecular weight of 271.27 g/mol. Its IUPAC name is (5S)-5-(4-fluorophenyl)sulfonyl-1,2-dihydropyrrole-5-carboxylic acid.
| Compound Name | (5S)-5-(4-fluorophenyl)sulfonyl-1,2-dihydropyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 122455974 |
| Molecular Formula | C11H10FNO4S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | (5S)-5-(4-fluorophenyl)sulfonyl-1,2-dihydropyrrole-5-carboxylic acid |
| SMILES | O=C(O)[C@@]1(S(=O)(=O)c2ccc(F)cc2)C=CCN1 |
| InChI | InChI=1S/C11H10FNO4S/c12-8-2-4-9(5-3-8)18(16,17)11(10(14)15)6-1-7-13-11/h1-6,13H,7H2,(H,14,15)/t11-/m0/s1 |
| InChIKey | UUYSGKQSPMAWRD-NSHDSACASA-N |
| XLogP | 0.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|