C10H8F2O2 — CID 131128796
1-fluoro-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 131128796) has the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. Its IUPAC name is 1-fluoro-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-fluoro-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 131128796 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 1-fluoro-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(F)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H8F2O2/c11-7-3-1-6(2-4-7)8-5-10(8,12)9(13)14/h1-4,8H,5H2,(H,13,14) |
| InChIKey | PXWCXHCAUGIPIJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |