C10H8ClFO — CID 45081780
2-(4-fluorophenyl)cyclopropane-1-carbonyl chloride (PubChem CID 45081780) has the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. Its IUPAC name is 2-(4-fluorophenyl)cyclopropane-1-carbonyl chloride.
| Compound Name | 2-(4-fluorophenyl)cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 45081780 |
| Molecular Formula | C10H8ClFO |
| Molecular Weight | 198.62 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 2-(4-fluorophenyl)cyclopropane-1-carbonyl chloride |
| SMILES | O=C(Cl)C1CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H8ClFO/c11-10(13)9-5-8(9)6-1-3-7(12)4-2-6/h1-4,8-9H,5H2 |
| InChIKey | QLMYVJCJGFUQIQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|