C11H12FNO — CID 42018488
(NZ)-N-[1-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]ethylidene]hydroxylamine (PubChem CID 42018488) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is (NZ)-N-[1-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 42018488 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (NZ)-N-[1-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)[C@H]1C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FNO/c1-7(13-14)10-6-11(10)8-2-4-9(12)5-3-8/h2-5,10-11,14H,6H2,1H3/b13-7-/t10-,11+/m1/s1 |
| InChIKey | LZZVLKBPGRAIAO-DFCPDCAHSA-N |
| XLogP | 2.78 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|