C11H12FN3O — CID 54517711
N-(diaminomethylidene)-2-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 54517711) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(4-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(diaminomethylidene)-2-(4-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 54517711 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-(diaminomethylidene)-2-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(N)=NC(=O)C1CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FN3O/c12-7-3-1-6(2-4-7)8-5-9(8)10(16)15-11(13)14/h1-4,8-9H,5H2,(H4,13,14,15,16) |
| InChIKey | YNOFKCOXMGGKEF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|