C10H9F2NO — CID 124562405
cis-(1R,2S)-2-(3,4-difluorophenyl)cyclopropane-1-carboxamide (PubChem CID 124562405) has the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3,4-difluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(3,4-difluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 124562405 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | cis-(1R,2S)-2-(3,4-difluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H9F2NO/c11-8-2-1-5(3-9(8)12)6-4-7(6)10(13)14/h1-3,6-7H,4H2,(H2,13,14)/t6-,7-/m1/s1 |
| InChIKey | PYEJQVYISBUGDU-RNFRBKRXSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |