C10H10ClNO — CID 131139995
trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 131139995) has the molecular formula C10H10ClNO and a molecular weight of 195.65 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 131139995 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | trans-(1S,2S)-2-(3-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=O)[C@H]1C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H10ClNO/c11-7-3-1-2-6(4-7)8-5-9(8)10(12)13/h1-4,8-9H,5H2,(H2,12,13)/t8-,9+/m1/s1 |
| InChIKey | IICYBLQRLHCKSO-BDAKNGLRSA-N |
| XLogP | 1.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |