C11H11ClO — CID 39239299
1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]ethanone (PubChem CID 39239299) has the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]ethanone.
| Compound Name | 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 39239299 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClO/c1-7(13)10-6-11(10)8-3-2-4-9(12)5-8/h2-5,10-11H,6H2,1H3/t10-,11+/m1/s1 |
| InChIKey | HIEVOMXOJBBJHH-MNOVXSKESA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |