C22H25FN2O — CID 7334337
trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]cyclopropane-1-carboxamide (PubChem CID 7334337) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7334337 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]cyclopropane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@@H]1C[C@H]1c1ccc(C(C)(C)C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O/c1-14(15-7-11-18(23)12-8-15)24-25-21(26)20-13-19(20)16-5-9-17(10-6-16)22(2,3)4/h5-12,19-20H,13H2,1-4H3,(H,25,26)/b24-14+/t19-,20+/m0/s1 |
| InChIKey | MYJOHEAQVGLUIX-MJEARJAWSA-N |
| XLogP | 4.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|