C27H28BrN3O3 — CID 29055567
5-bromo-N-[4-[(E)-N-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide (PubChem CID 29055567) has the molecular formula C27H28BrN3O3 and a molecular weight of 522.44 g/mol. Its IUPAC name is 5-bromo-N-[4-[(E)-N-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[(E)-N-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 29055567 |
| Molecular Formula | C27H28BrN3O3 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 5-bromo-N-[4-[(E)-N-[[(1S,2R)-2-(4-tert-butylphenyl)cyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]furan-2-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@H]1C[C@H]1c1ccc(C(C)(C)C)cc1)c1ccc(NC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C27H28BrN3O3/c1-16(17-7-11-20(12-8-17)29-26(33)23-13-14-24(28)34-23)30-31-25(32)22-15-21(22)18-5-9-19(10-6-18)27(2,3)4/h5-14,21-22H,15H2,1-4H3,(H,29,33)(H,31,32)/b30-16+/t21-,22-/m0/s1 |
| InChIKey | SRXMNSOVVSRWKH-CDCWNZRFSA-N |
| XLogP | 6.24 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|