C24H25N3O3 — CID 172982960
methane;N-[4-[(E)-C-methyl-N-[(2-phenylcyclopropanecarbonyl)amino]carbonimidoyl]phenyl]furan-2-carboxamide (PubChem CID 172982960) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is methane;N-[4-[(E)-C-methyl-N-[(2-phenylcyclopropanecarbonyl)amino]carbonimidoyl]phenyl]furan-2-carboxamide.
| Compound Name | methane;N-[4-[(E)-C-methyl-N-[(2-phenylcyclopropanecarbonyl)amino]carbonimidoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 172982960 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | methane;N-[4-[(E)-C-methyl-N-[(2-phenylcyclopropanecarbonyl)amino]carbonimidoyl]phenyl]furan-2-carboxamide |
| SMILES | C.C/C(=N\NC(=O)C1CC1c1ccccc1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H21N3O3.CH4/c1-15(25-26-22(27)20-14-19(20)17-6-3-2-4-7-17)16-9-11-18(12-10-16)24-23(28)21-8-5-13-29-21;/h2-13,19-20H,14H2,1H3,(H,24,28)(H,26,27);1H4/b25-15+; |
| InChIKey | MNGBOHBVVOSHJT-BUWMAIPZSA-N |
| XLogP | 4.81 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|