C20H15BrClN3O3 — CID 6027501
5-bromo-N-[(Z)-1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide (PubChem CID 6027501) has the molecular formula C20H15BrClN3O3 and a molecular weight of 460.72 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6027501 |
| Molecular Formula | C20H15BrClN3O3 |
| Molecular Weight | 460.72 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 5-bromo-N-[(Z)-1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]furan-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(Br)o1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H15BrClN3O3/c1-12(24-25-20(27)17-10-11-18(21)28-17)13-4-8-16(9-5-13)23-19(26)14-2-6-15(22)7-3-14/h2-11H,1H3,(H,23,26)(H,25,27)/b24-12- |
| InChIKey | FJAULRVJJGMKGO-MSXFZWOLSA-N |
| XLogP | 5.10 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|