C22H18ClN3O5 — CID 3465432
N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-3,4,5-trihydroxybenzamide (PubChem CID 3465432) has the molecular formula C22H18ClN3O5 and a molecular weight of 439.86 g/mol. Its IUPAC name is N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 3465432 |
| Molecular Formula | C22H18ClN3O5 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-3,4,5-trihydroxybenzamide |
| SMILES | CC(=NNC(=O)c1cc(O)c(O)c(O)c1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18ClN3O5/c1-12(25-26-22(31)15-10-18(27)20(29)19(28)11-15)13-4-8-17(9-5-13)24-21(30)14-2-6-16(23)7-3-14/h2-11,27-29H,1H3,(H,24,30)(H,26,31) |
| InChIKey | GLLWESHWVABGRI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|