C28H22ClN3O2 — CID 4099820
N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-phenylbenzamide (PubChem CID 4099820) has the molecular formula C28H22ClN3O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-phenylbenzamide.
| Compound Name | N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 4099820 |
| Molecular Formula | C28H22ClN3O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-phenylbenzamide |
| SMILES | CC(=NNC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H22ClN3O2/c1-19(20-13-17-26(18-14-20)30-27(33)23-11-15-25(29)16-12-23)31-32-28(34)24-9-7-22(8-10-24)21-5-3-2-4-6-21/h2-18H,1H3,(H,30,33)(H,32,34) |
| InChIKey | QJJBKVHQPZFJPX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|