C22H18ClN3O3 — CID 4051552
N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-hydroxybenzamide (PubChem CID 4051552) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 4051552 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[1-[4-[(4-chlorobenzoyl)amino]phenyl]ethylideneamino]-4-hydroxybenzamide |
| SMILES | CC(=NNC(=O)c1ccc(O)cc1)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18ClN3O3/c1-14(25-26-22(29)17-6-12-20(27)13-7-17)15-4-10-19(11-5-15)24-21(28)16-2-8-18(23)9-3-16/h2-13,27H,1H3,(H,24,28)(H,26,29) |
| InChIKey | UQSGGBAZQBWACM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|