C16H16N2O4 — CID 5009394
3,4,5-trihydroxy-N-[1-(4-methylphenyl)ethylideneamino]benzamide (PubChem CID 5009394) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[1-(4-methylphenyl)ethylideneamino]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[1-(4-methylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 5009394 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3,4,5-trihydroxy-N-[1-(4-methylphenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1cc(O)c(O)c(O)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-9-3-5-11(6-4-9)10(2)17-18-16(22)12-7-13(19)15(21)14(20)8-12/h3-8,19-21H,1-2H3,(H,18,22) |
| InChIKey | DZAUODMQIKNTPT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|