C14H13N3O4 — CID 903912
3,4,5-trihydroxy-N-(1-pyridin-4-ylethylideneamino)benzamide (PubChem CID 903912) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-(1-pyridin-4-ylethylideneamino)benzamide.
| Compound Name | 3,4,5-trihydroxy-N-(1-pyridin-4-ylethylideneamino)benzamide |
|---|---|
| PubChem CID | 903912 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3,4,5-trihydroxy-N-(1-pyridin-4-ylethylideneamino)benzamide |
| SMILES | CC(=NNC(=O)c1cc(O)c(O)c(O)c1)c1ccncc1 |
| InChI | InChI=1S/C14H13N3O4/c1-8(9-2-4-15-5-3-9)16-17-14(21)10-6-11(18)13(20)12(19)7-10/h2-7,18-20H,1H3,(H,17,21) |
| InChIKey | AGZHUUOPADCILW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|