C13H12N2O4S — CID 6029877
3,4,5-trihydroxy-N-[(E)-1-thiophen-2-ylethylideneamino]benzamide (PubChem CID 6029877) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[(E)-1-thiophen-2-ylethylideneamino]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[(E)-1-thiophen-2-ylethylideneamino]benzamide |
|---|---|
| PubChem CID | 6029877 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3,4,5-trihydroxy-N-[(E)-1-thiophen-2-ylethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1cc(O)c(O)c(O)c1)c1cccs1 |
| InChI | InChI=1S/C13H12N2O4S/c1-7(11-3-2-4-20-11)14-15-13(19)8-5-9(16)12(18)10(17)6-8/h2-6,16-18H,1H3,(H,15,19)/b14-7+ |
| InChIKey | SBUDSJBDCGUDDD-VGOFMYFVSA-N |
| XLogP | 2.02 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|