C26H32N2O — CID 129440316
trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]cyclopropane-1-carboxamide (PubChem CID 129440316) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129440316 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | trans-(1R,2R)-2-(4-tert-butylphenyl)-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]cyclopropane-1-carboxamide |
| SMILES | CC(=NNC(=O)[C@@H]1C[C@H]1c1ccc(C(C)(C)C)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C26H32N2O/c1-17(20-10-9-18-7-5-6-8-21(18)15-20)27-28-25(29)24-16-23(24)19-11-13-22(14-12-19)26(2,3)4/h9-15,23-24H,5-8,16H2,1-4H3,(H,28,29)/t23-,24+/m0/s1 |
| InChIKey | RXIKSWCXUIEGBY-BJKOFHAPSA-N |
| XLogP | 5.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|