C20H22N2O — CID 40555202
cis-(1R,2S)-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 40555202) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40555202 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | cis-(1R,2S)-N-[(Z)-1-(3,4-dimethylphenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C/C(=N/NC(=O)[C@@H]1C[C@@H]1c1ccccc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C20H22N2O/c1-13-9-10-17(11-14(13)2)15(3)21-22-20(23)19-12-18(19)16-7-5-4-6-8-16/h4-11,18-19H,12H2,1-3H3,(H,22,23)/b21-15-/t18-,19-/m1/s1 |
| InChIKey | VEBHSGXYFKPBGH-RBMXQFEISA-N |
| XLogP | 3.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|