C18H17BrN2O — CID 73353906
trans-(1R,2R)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 73353906) has the molecular formula C18H17BrN2O and a molecular weight of 357.25 g/mol. Its IUPAC name is trans-(1R,2R)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 73353906 |
| Molecular Formula | C18H17BrN2O |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | trans-(1R,2R)-N-[(E)-1-(3-bromophenyl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@@H]1C[C@H]1c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H17BrN2O/c1-12(14-8-5-9-15(19)10-14)20-21-18(22)17-11-16(17)13-6-3-2-4-7-13/h2-10,16-17H,11H2,1H3,(H,21,22)/b20-12+/t16-,17+/m0/s1 |
| InChIKey | JIOAKYSLHBPASE-QWSZEGLUSA-N |
| XLogP | 4.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|