C15H11ClFNO — CID 87545136
2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carbonyl chloride (PubChem CID 87545136) has the molecular formula C15H11ClFNO and a molecular weight of 275.71 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carbonyl chloride.
| Compound Name | 2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 87545136 |
| Molecular Formula | C15H11ClFNO |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carbonyl chloride |
| SMILES | O=C(Cl)C1CC1c1ccc(-c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C15H11ClFNO/c16-15(19)13-7-12(13)10-3-6-14(18-8-10)9-1-4-11(17)5-2-9/h1-6,8,12-13H,7H2 |
| InChIKey | YXXHPQRJBHLMDB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|