C10H10ClNO2 — CID 129244238
trans-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbonyl chloride (PubChem CID 129244238) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is trans-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbonyl chloride.
| Compound Name | trans-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 129244238 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | trans-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbonyl chloride |
| SMILES | COc1ccc([C@@H]2C[C@H]2C(=O)Cl)cn1 |
| InChI | InChI=1S/C10H10ClNO2/c1-14-9-3-2-6(5-12-9)7-4-8(7)10(11)13/h2-3,5,7-8H,4H2,1H3/t7-,8+/m0/s1 |
| InChIKey | FMFVFNUEUMPWKR-JGVFFNPUSA-N |
| XLogP | 1.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|