C13H17NO3 — CID 59988842
ethyl 2-[2-(6-methoxy-3-pyridinyl)cyclopropyl]acetate (PubChem CID 59988842) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is ethyl 2-[2-(6-methoxy-3-pyridinyl)cyclopropyl]acetate.
| Compound Name | ethyl 2-[2-(6-methoxy-3-pyridinyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 59988842 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethyl 2-[2-(6-methoxy-3-pyridinyl)cyclopropyl]acetate |
| SMILES | CCOC(=O)CC1CC1c1ccc(OC)nc1 |
| InChI | InChI=1S/C13H17NO3/c1-3-17-13(15)7-10-6-11(10)9-4-5-12(16-2)14-8-9/h4-5,8,10-11H,3,6-7H2,1-2H3 |
| InChIKey | NHWBXXBZODSJLS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |