C10H11NO2 — CID 130863052
cis-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbaldehyde (PubChem CID 130863052) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is cis-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 130863052 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | cis-(1R,2R)-2-(6-methoxy-3-pyridinyl)cyclopropane-1-carbaldehyde |
| SMILES | COc1ccc([C@@H]2C[C@H]2C=O)cn1 |
| InChI | InChI=1S/C10H11NO2/c1-13-10-3-2-7(5-11-10)9-4-8(9)6-12/h2-3,5-6,8-9H,4H2,1H3/t8-,9-/m0/s1 |
| InChIKey | WUTHSKUCQINFIF-IUCAKERBSA-N |
| XLogP | 1.39 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|