C11H11FN2O3S — CID 167917231
N-(4-fluorophenyl)sulfonyl-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 167917231) has the molecular formula C11H11FN2O3S and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)sulfonyl-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)sulfonyl-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 167917231 |
| Molecular Formula | C11H11FN2O3S |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | N-(4-fluorophenyl)sulfonyl-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(F)cc1)C1C=CCN1 |
| InChI | InChI=1S/C11H11FN2O3S/c12-8-3-5-9(6-4-8)18(16,17)14-11(15)10-2-1-7-13-10/h1-6,10,13H,7H2,(H,14,15) |
| InChIKey | HYYOBPOKROFNHL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|