C16H15Cl2FN2O3S — CID 66935355
(E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-(4-fluorophenyl)prop-2-enamide;hydrochloride (PubChem CID 66935355) has the molecular formula C16H15Cl2FN2O3S and a molecular weight of 405.28 g/mol. Its IUPAC name is (E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-(4-fluorophenyl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-(4-fluorophenyl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 66935355 |
| Molecular Formula | C16H15Cl2FN2O3S |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (E)-2-(aminomethyl)-N-(4-chlorophenyl)sulfonyl-3-(4-fluorophenyl)prop-2-enamide;hydrochloride |
| SMILES | Cl.NC/C(=C\c1ccc(F)cc1)C(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClFN2O3S.ClH/c17-13-3-7-15(8-4-13)24(22,23)20-16(21)12(10-19)9-11-1-5-14(18)6-2-11;/h1-9H,10,19H2,(H,20,21);1H/b12-9+; |
| InChIKey | HZIMLCIRIYDAKB-NBYYMMLRSA-N |
| XLogP | 2.75 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|