C22H16ClFN2O4S — CID 16734957
1-(4-chlorophenyl)sulfonyl-3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]urea (PubChem CID 16734957) has the molecular formula C22H16ClFN2O4S and a molecular weight of 458.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]urea |
|---|---|
| PubChem CID | 16734957 |
| Molecular Formula | C22H16ClFN2O4S |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-[4-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccc(F)cc2)cc1)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClFN2O4S/c23-17-6-12-20(13-7-17)31(29,30)26-22(28)25-19-10-4-16(5-11-19)21(27)14-3-15-1-8-18(24)9-2-15/h1-14H,(H2,25,26,28)/b14-3+ |
| InChIKey | KCYRRUIZQICGEM-LZWSPWQCSA-N |
| XLogP | 4.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|