C22H15ClFNO2 — CID 177378529
4-chloro-N-[3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]benzamide (PubChem CID 177378529) has the molecular formula C22H15ClFNO2 and a molecular weight of 379.82 g/mol. Its IUPAC name is 4-chloro-N-[3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 177378529 |
| Molecular Formula | C22H15ClFNO2 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 4-chloro-N-[3-[(E)-3-(4-fluorophenyl)prop-2-enoyl]phenyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)c1cccc(NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H15ClFNO2/c23-18-9-7-16(8-10-18)22(27)25-20-3-1-2-17(14-20)21(26)13-6-15-4-11-19(24)12-5-15/h1-14H,(H,25,27)/b13-6+ |
| InChIKey | CCCWBUURASCWHC-AWNIVKPZSA-N |
| XLogP | 5.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|