C23H19FN2O2 — CID 26158897
N-(4-fluorophenyl)-3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 26158897) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-(4-fluorophenyl)-3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 26158897 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(4-fluorophenyl)-3-[[(E)-3-(4-methylphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cccc(C(=O)Nc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C23H19FN2O2/c1-16-5-7-17(8-6-16)9-14-22(27)25-21-4-2-3-18(15-21)23(28)26-20-12-10-19(24)11-13-20/h2-15H,1H3,(H,25,27)(H,26,28)/b14-9+ |
| InChIKey | UCTNOGZSBFNDKZ-NTEUORMPSA-N |
| XLogP | 5.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|