C30H23ClN6O — CID 45028633
(E)-3-(4-chlorophenyl)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]prop-2-en-1-one (PubChem CID 45028633) has the molecular formula C30H23ClN6O and a molecular weight of 519.01 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45028633 |
| Molecular Formula | C30H23ClN6O |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[3-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)c1cccc(Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C30H23ClN6O/c31-23-17-14-21(15-18-23)16-19-27(38)22-8-7-13-26(20-22)34-30-36-28(32-24-9-3-1-4-10-24)35-29(37-30)33-25-11-5-2-6-12-25/h1-20H,(H3,32,33,34,35,36,37)/b19-16+ |
| InChIKey | PBVBPNGOWYTQAH-KNTRCKAVSA-N |
| XLogP | 7.65 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|