C32H27ClFN7O — CID 45028715
(E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one (PubChem CID 45028715) has the molecular formula C32H27ClFN7O and a molecular weight of 580.07 g/mol. Its IUPAC name is (E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45028715 |
| Molecular Formula | C32H27ClFN7O |
| Molecular Weight | 580.07 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | (E)-1-[4-[[4-(4-chloroanilino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenyl]-3-[4-(dimethylamino)phenyl]prop-2-en-1-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)c2ccc(Nc3nc(Nc4ccc(F)cc4)nc(Nc4ccc(Cl)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C32H27ClFN7O/c1-41(2)28-18-3-21(4-19-28)5-20-29(42)22-6-12-25(13-7-22)35-30-38-31(36-26-14-8-23(33)9-15-26)40-32(39-30)37-27-16-10-24(34)11-17-27/h3-20H,1-2H3,(H3,35,36,37,38,39,40)/b20-5+ |
| InChIKey | FYAVSCQPISVICA-DENHBWNVSA-N |
| XLogP | 7.86 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.07 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|