C24H21ClN4 — CID 162677755
N-(4-chlorophenyl)-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-amine (PubChem CID 162677755) has the molecular formula C24H21ClN4 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-amine.
| Compound Name | N-(4-chlorophenyl)-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 162677755 |
| Molecular Formula | C24H21ClN4 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]quinazolin-4-amine |
| SMILES | CN(C)c1ccc(/C=C/c2nc(Nc3ccc(Cl)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H21ClN4/c1-29(2)20-14-7-17(8-15-20)9-16-23-27-22-6-4-3-5-21(22)24(28-23)26-19-12-10-18(25)11-13-19/h3-16H,1-2H3,(H,26,27,28)/b16-9+ |
| InChIKey | SCNPYXSXSYCHSK-CXUHLZMHSA-N |
| XLogP | 6.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|