C20H21ClN6 — CID 22667933
2-[3-[[2-[(E)-2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]amino]propyl]guanidine (PubChem CID 22667933) has the molecular formula C20H21ClN6 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-[3-[[2-[(E)-2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[2-[(E)-2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 22667933 |
| Molecular Formula | C20H21ClN6 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[3-[[2-[(E)-2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]amino]propyl]guanidine |
| SMILES | NC(N)=NCCCNc1nc(/C=C/c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H21ClN6/c21-15-9-6-14(7-10-15)8-11-18-26-17-5-2-1-4-16(17)19(27-18)24-12-3-13-25-20(22)23/h1-2,4-11H,3,12-13H2,(H4,22,23,25)(H,24,26,27)/b11-8+ |
| InChIKey | OLPJFKSYRGONBV-DHZHZOJOSA-N |
| XLogP | 3.53 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|