C26H33ClN4 — CID 69150115
N'-[6-tert-butyl-2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]hexane-1,6-diamine (PubChem CID 69150115) has the molecular formula C26H33ClN4 and a molecular weight of 437.03 g/mol. Its IUPAC name is N'-[6-tert-butyl-2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]hexane-1,6-diamine.
| Compound Name | N'-[6-tert-butyl-2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 69150115 |
| Molecular Formula | C26H33ClN4 |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N'-[6-tert-butyl-2-[2-(4-chlorophenyl)ethenyl]quinazolin-4-yl]hexane-1,6-diamine |
| SMILES | CC(C)(C)c1ccc2nc(C=Cc3ccc(Cl)cc3)nc(NCCCCCCN)c2c1 |
| InChI | InChI=1S/C26H33ClN4/c1-26(2,3)20-11-14-23-22(18-20)25(29-17-7-5-4-6-16-28)31-24(30-23)15-10-19-8-12-21(27)13-9-19/h8-15,18H,4-7,16-17,28H2,1-3H3,(H,29,30,31) |
| InChIKey | LSITXMMAEPOKRM-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|