C22H25ClN4O — CID 121453058
N-[6-chloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121453058) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121453058 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(/C=C/c2nc(NCCCN(C)C)c3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C22H25ClN4O/c1-27(2)14-4-13-24-22-19-15-17(23)8-11-20(19)25-21(26-22)12-7-16-5-9-18(28-3)10-6-16/h5-12,15H,4,13-14H2,1-3H3,(H,24,25,26)/b12-7+ |
| InChIKey | FRLDFEDEWRMXBS-KPKJPENVSA-N |
| XLogP | 4.83 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|