C24H28ClN5O2 — CID 162644242
N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 162644242) has the molecular formula C24H28ClN5O2 and a molecular weight of 453.97 g/mol. Its IUPAC name is N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 162644242 |
| Molecular Formula | C24H28ClN5O2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[6-chloro-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-yl]-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNc1nc(/C=C/c2ccc([N+](=O)[O-])cc2)nc2ccc(Cl)cc12)C(C)C |
| InChI | InChI=1S/C24H28ClN5O2/c1-16(2)29(17(3)4)14-13-26-24-21-15-19(25)8-11-22(21)27-23(28-24)12-7-18-5-9-20(10-6-18)30(31)32/h5-12,15-17H,13-14H2,1-4H3,(H,26,27,28)/b12-7+ |
| InChIKey | WIOTUMURLYOEBP-KPKJPENVSA-N |
| XLogP | 5.89 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|