C25H26ClFN4O4 — CID 90647151
(E)-but-2-enedioic acid;N-[6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 90647151) has the molecular formula C25H26ClFN4O4 and a molecular weight of 500.96 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | (E)-but-2-enedioic acid;N-[6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 90647151 |
| Molecular Formula | C25H26ClFN4O4 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[6-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(/C=C/c2ccc(F)cc2)nc2ccc(Cl)cc12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H22ClFN4.C4H4O4/c1-27(2)13-3-12-24-21-18-14-16(22)7-10-19(18)25-20(26-21)11-6-15-4-8-17(23)9-5-15;5-3(6)1-2-4(7)8/h4-11,14H,3,12-13H2,1-2H3,(H,24,25,26);1-2H,(H,5,6)(H,7,8)/b11-6+;2-1+ |
| InChIKey | QPCFKXSHSGOHGX-PTYYMQOGSA-N |
| XLogP | 4.67 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|