C22H24Cl2N4 — CID 121402520
N-[7-chloro-2-[(E)-2-(4-chloro-3-methylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 121402520) has the molecular formula C22H24Cl2N4 and a molecular weight of 415.37 g/mol. Its IUPAC name is N-[7-chloro-2-[(E)-2-(4-chloro-3-methylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[7-chloro-2-[(E)-2-(4-chloro-3-methylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121402520 |
| Molecular Formula | C22H24Cl2N4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[7-chloro-2-[(E)-2-(4-chloro-3-methylphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cc(/C=C/c2nc(NCCCN(C)C)c3ccc(Cl)cc3n2)ccc1Cl |
| InChI | InChI=1S/C22H24Cl2N4/c1-15-13-16(5-9-19(15)24)6-10-21-26-20-14-17(23)7-8-18(20)22(27-21)25-11-4-12-28(2)3/h5-10,13-14H,4,11-12H2,1-3H3,(H,25,26,27)/b10-6+ |
| InChIKey | XKUCJSXCXNOHRJ-UXBLZVDNSA-N |
| XLogP | 5.78 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|