C20H20ClIN4 — CID 118736489
N-[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-iodoquinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 118736489) has the molecular formula C20H20ClIN4 and a molecular weight of 478.77 g/mol. Its IUPAC name is N-[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-iodoquinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-iodoquinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 118736489 |
| Molecular Formula | C20H20ClIN4 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | N-[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-iodoquinazolin-4-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(/C=C/c2ccc(Cl)cc2)nc2ccc(I)cc12 |
| InChI | InChI=1S/C20H20ClIN4/c1-26(2)12-11-23-20-17-13-16(22)8-9-18(17)24-19(25-20)10-5-14-3-6-15(21)7-4-14/h3-10,13H,11-12H2,1-2H3,(H,23,24,25)/b10-5+ |
| InChIKey | BYCRZDAWDHMBHV-BJMVGYQFSA-N |
| XLogP | 5.03 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|