About N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine
N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine (PubChem CID 118736578) has the molecular formula C22H19ClN4
and a molecular weight of 374.88 g/mol. Its IUPAC name is N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine |
| PubChem CID | 118736578 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine |
| SMILES | NCCNc1nc(/C=C/c2ccc(Cl)cc2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C22H19ClN4/c23-18-8-5-15(6-9-18)7-10-21-26-20-14-17-4-2-1-3-16(17)13-19(20)22(27-21)25-12-11-24/h1-10,13-14H,11-12,24H2,(H,25,26,27)/b10-7+ |
| InChIKey | OETDTSFVQFMRCJ-JXMROGBWSA-N |
| XLogP | 4.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine?
The IUPAC name of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine (CID 118736578) is N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine is NCCNc1nc(/C=C/c2ccc(Cl)cc2)nc2cc3ccccc3cc12.
What is the InChIKey of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine?
The InChIKey is OETDTSFVQFMRCJ-JXMROGBWSA-N. The full InChI is InChI=1S/C22H19ClN4/c23-18-8-5-15(6-9-18)7-10-21-26-20-14-17-4-2-1-3-16(17)13-19(20)22(27-21)25-12-11-24/h1-10,13-14H,11-12,24H2,(H,25,26,27)/b10-7+.
What are the key properties of N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine?
N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine has a molecular weight of 374.88 g/mol, XLogP of 4.98, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine is sourced from PubChem (CID 118736578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).