C22H19ClN4 — CID 118736578
N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine (PubChem CID 118736578) has the molecular formula C22H19ClN4 and a molecular weight of 374.88 g/mol. Its IUPAC name is N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine.
| Compound Name | N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 118736578 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N'-[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]ethane-1,2-diamine |
| SMILES | NCCNc1nc(/C=C/c2ccc(Cl)cc2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C22H19ClN4/c23-18-8-5-15(6-9-18)7-10-21-26-20-14-17-4-2-1-3-16(17)13-19(20)22(27-21)25-12-11-24/h1-10,13-14H,11-12,24H2,(H,25,26,27)/b10-7+ |
| InChIKey | OETDTSFVQFMRCJ-JXMROGBWSA-N |
| XLogP | 4.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|