C27H27ClN4O2 — CID 118736573
tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]amino]ethyl]carbamate (PubChem CID 118736573) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 118736573 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | tert-butyl N-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]benzo[g]quinazolin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nc(/C=C/c2ccc(Cl)cc2)nc2cc3ccccc3cc12 |
| InChI | InChI=1S/C27H27ClN4O2/c1-27(2,3)34-26(33)30-15-14-29-25-22-16-19-6-4-5-7-20(19)17-23(22)31-24(32-25)13-10-18-8-11-21(28)12-9-18/h4-13,16-17H,14-15H2,1-3H3,(H,30,33)(H,29,31,32)/b13-10+ |
| InChIKey | VVMMKHDHZNZYED-JLHYYAGUSA-N |
| XLogP | 6.54 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|