C24H27ClFN5 — CID 121453160
7-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]quinazolin-4-amine (PubChem CID 121453160) has the molecular formula C24H27ClFN5 and a molecular weight of 439.97 g/mol. Its IUPAC name is 7-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]quinazolin-4-amine.
| Compound Name | 7-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 121453160 |
| Molecular Formula | C24H27ClFN5 |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 7-chloro-2-[(E)-2-(4-fluorophenyl)ethenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]quinazolin-4-amine |
| SMILES | CN1CCN(CCCNc2nc(/C=C/c3ccc(F)cc3)nc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C24H27ClFN5/c1-30-13-15-31(16-14-30)12-2-11-27-24-21-9-6-19(25)17-22(21)28-23(29-24)10-5-18-3-7-20(26)8-4-18/h3-10,17H,2,11-16H2,1H3,(H,27,28,29)/b10-5+ |
| InChIKey | BTHUBGNXAANILN-BJMVGYQFSA-N |
| XLogP | 4.64 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|