C21H22FN5O3 — CID 69229320
7-fluoro-2-[2-(5-nitrofuran-2-yl)ethenyl]-N-(3-pyrrolidin-1-ylpropyl)quinazolin-4-amine (PubChem CID 69229320) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is 7-fluoro-2-[2-(5-nitrofuran-2-yl)ethenyl]-N-(3-pyrrolidin-1-ylpropyl)quinazolin-4-amine.
| Compound Name | 7-fluoro-2-[2-(5-nitrofuran-2-yl)ethenyl]-N-(3-pyrrolidin-1-ylpropyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 69229320 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 7-fluoro-2-[2-(5-nitrofuran-2-yl)ethenyl]-N-(3-pyrrolidin-1-ylpropyl)quinazolin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2nc(NCCCN3CCCC3)c3ccc(F)cc3n2)o1 |
| InChI | InChI=1S/C21H22FN5O3/c22-15-4-7-17-18(14-15)24-19(8-5-16-6-9-20(30-16)27(28)29)25-21(17)23-10-3-13-26-11-1-2-12-26/h4-9,14H,1-3,10-13H2,(H,23,24,25) |
| InChIKey | QIJQFYGMZQXLFS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|