C22H16FN5O6 — CID 59774690
4-[[5-fluoro-6-(4-hydroxyanilino)-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyrimidin-4-yl]amino]benzene-1,2-diol (PubChem CID 59774690) has the molecular formula C22H16FN5O6 and a molecular weight of 465.40 g/mol. Its IUPAC name is 4-[[5-fluoro-6-(4-hydroxyanilino)-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyrimidin-4-yl]amino]benzene-1,2-diol.
| Compound Name | 4-[[5-fluoro-6-(4-hydroxyanilino)-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyrimidin-4-yl]amino]benzene-1,2-diol |
|---|---|
| PubChem CID | 59774690 |
| Molecular Formula | C22H16FN5O6 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 4-[[5-fluoro-6-(4-hydroxyanilino)-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyrimidin-4-yl]amino]benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2nc(Nc3ccc(O)cc3)c(F)c(Nc3ccc(O)c(O)c3)n2)o1 |
| InChI | InChI=1S/C22H16FN5O6/c23-20-21(24-12-1-4-14(29)5-2-12)26-18(9-6-15-7-10-19(34-15)28(32)33)27-22(20)25-13-3-8-16(30)17(31)11-13/h1-11,29-31H,(H2,24,25,26,27)/b9-6+ |
| InChIKey | QBQUBLXALPILMK-RMKNXTFCSA-N |
| XLogP | 4.89 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|