C28H32FN5O5 — CID 145476465
ethane;4-[[7-fluoro-6-morpholin-4-yl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol (PubChem CID 145476465) has the molecular formula C28H32FN5O5 and a molecular weight of 537.59 g/mol. Its IUPAC name is ethane;4-[[7-fluoro-6-morpholin-4-yl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol.
| Compound Name | ethane;4-[[7-fluoro-6-morpholin-4-yl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 145476465 |
| Molecular Formula | C28H32FN5O5 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | ethane;4-[[7-fluoro-6-morpholin-4-yl-2-[(E)-2-(5-nitrofuran-2-yl)ethenyl]quinazolin-4-yl]amino]phenol |
| SMILES | CC.CC.O=[N+]([O-])c1ccc(/C=C/c2nc(Nc3ccc(O)cc3)c3cc(N4CCOCC4)c(F)cc3n2)o1 |
| InChI | InChI=1S/C24H20FN5O5.2C2H6/c25-19-14-20-18(13-21(19)29-9-11-34-12-10-29)24(26-15-1-3-16(31)4-2-15)28-22(27-20)7-5-17-6-8-23(35-17)30(32)33;2*1-2/h1-8,13-14,31H,9-12H2,(H,26,27,28);2*1-2H3/b7-5+;; |
| InChIKey | WXIPOZTUNWOYCE-WVKUUHRJSA-N |
| XLogP | 6.78 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|