C10H12N4O5 — CID 6444719
N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]morpholine-4-carboxamide (PubChem CID 6444719) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]morpholine-4-carboxamide.
| Compound Name | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 6444719 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]morpholine-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])o1)N1CCOCC1 |
| InChI | InChI=1S/C10H12N4O5/c15-10(13-3-5-18-6-4-13)12-11-7-8-1-2-9(19-8)14(16)17/h1-2,7H,3-6H2,(H,12,15)/b11-7- |
| InChIKey | NVAUCWNDTOEUTI-XFFZJAGNSA-N |
| XLogP | 0.56 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|