C18H22N8O7 — CID 45125653
2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide (PubChem CID 45125653) has the molecular formula C18H22N8O7 and a molecular weight of 462.42 g/mol. Its IUPAC name is 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide.
| Compound Name | 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 45125653 |
| Molecular Formula | C18H22N8O7 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
| SMILES | O=C(COc1nc(N2CCOCC2)nc(N2CCOCC2)n1)N/N=C/c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H22N8O7/c27-14(23-19-11-13-1-2-15(33-13)26(28)29)12-32-18-21-16(24-3-7-30-8-4-24)20-17(22-18)25-5-9-31-10-6-25/h1-2,11H,3-10,12H2,(H,23,27)/b19-11+ |
| InChIKey | OCYJZCZSMYGISJ-YBFXNURJSA-N |
| XLogP | -0.42 |
| TPSA | 170.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|